About 2-(1,4-diazepan-1-yl)-2,3-dimethylpentanenitrile
2-(1,4-diazepan-1-yl)-2,3-dimethylpentanenitrile (PubChem CID 61005809) has the molecular formula C12H23N3
and a molecular weight of 209.34 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-2,3-dimethylpentanenitrile.
Molecular Properties
| Compound Name | 2-(1,4-diazepan-1-yl)-2,3-dimethylpentanenitrile |
| PubChem CID | 61005809 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-2,3-dimethylpentanenitrile |
| SMILES | CCC(C)C(C)(C#N)N1CCCNCC1 |
| InChI | InChI=1S/C12H23N3/c1-4-11(2)12(3,10-13)15-8-5-6-14-7-9-15/h11,14H,4-9H2,1-3H3 |
| InChIKey | DXCVYVWYDKUEKM-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1,4-diazepan-1-yl)-2,3-dimethylpentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,4-diazepan-1-yl)-2,3-dimethylpentanenitrile?
The IUPAC name of 2-(1,4-diazepan-1-yl)-2,3-dimethylpentanenitrile (CID 61005809) is 2-(1,4-diazepan-1-yl)-2,3-dimethylpentanenitrile.
What is the SMILES notation for 2-(1,4-diazepan-1-yl)-2,3-dimethylpentanenitrile?
The canonical SMILES for 2-(1,4-diazepan-1-yl)-2,3-dimethylpentanenitrile is CCC(C)C(C)(C#N)N1CCCNCC1.
What is the InChIKey of 2-(1,4-diazepan-1-yl)-2,3-dimethylpentanenitrile?
The InChIKey is DXCVYVWYDKUEKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3/c1-4-11(2)12(3,10-13)15-8-5-6-14-7-9-15/h11,14H,4-9H2,1-3H3.
What are the key properties of 2-(1,4-diazepan-1-yl)-2,3-dimethylpentanenitrile?
2-(1,4-diazepan-1-yl)-2,3-dimethylpentanenitrile has a molecular weight of 209.34 g/mol, XLogP of 1.61, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,4-diazepan-1-yl)-2,3-dimethylpentanenitrile is sourced from PubChem (CID 61005809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).