About 1H-[1]benzofuro[3,2-f]indole
1H-[1]benzofuro[3,2-f]indole (PubChem CID 610059) has the molecular formula C14H9NO
and a molecular weight of 207.23 g/mol. Its IUPAC name is 1H-[1]benzofuro[3,2-f]indole.
Molecular Properties
| Compound Name | 1H-[1]benzofuro[3,2-f]indole |
| PubChem CID | 610059 |
| Molecular Formula | C14H9NO |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 1H-[1]benzofuro[3,2-f]indole |
| SMILES | c1ccc2c(c1)oc1cc3[nH]ccc3cc12 |
| InChI | InChI=1S/C14H9NO/c1-2-4-13-10(3-1)11-7-9-5-6-15-12(9)8-14(11)16-13/h1-8,15H |
| InChIKey | CEDQNXDXMSURRT-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1H-[1]benzofuro[3,2-f]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-[1]benzofuro[3,2-f]indole?
The IUPAC name of 1H-[1]benzofuro[3,2-f]indole (CID 610059) is 1H-[1]benzofuro[3,2-f]indole.
What is the SMILES notation for 1H-[1]benzofuro[3,2-f]indole?
The canonical SMILES for 1H-[1]benzofuro[3,2-f]indole is c1ccc2c(c1)oc1cc3[nH]ccc3cc12.
What is the InChIKey of 1H-[1]benzofuro[3,2-f]indole?
The InChIKey is CEDQNXDXMSURRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9NO/c1-2-4-13-10(3-1)11-7-9-5-6-15-12(9)8-14(11)16-13/h1-8,15H.
What are the key properties of 1H-[1]benzofuro[3,2-f]indole?
1H-[1]benzofuro[3,2-f]indole has a molecular weight of 207.23 g/mol, XLogP of 4.07, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-[1]benzofuro[3,2-f]indole is sourced from PubChem (CID 610059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).