About 2-(1,4-diazepan-1-yl)-2,5-dimethylhexanenitrile
2-(1,4-diazepan-1-yl)-2,5-dimethylhexanenitrile (PubChem CID 61006060) has the molecular formula C13H25N3
and a molecular weight of 223.36 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-2,5-dimethylhexanenitrile.
Molecular Properties
| Compound Name | 2-(1,4-diazepan-1-yl)-2,5-dimethylhexanenitrile |
| PubChem CID | 61006060 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-2,5-dimethylhexanenitrile |
| SMILES | CC(C)CCC(C)(C#N)N1CCCNCC1 |
| InChI | InChI=1S/C13H25N3/c1-12(2)5-6-13(3,11-14)16-9-4-7-15-8-10-16/h12,15H,4-10H2,1-3H3 |
| InChIKey | FOAZALMPDFHLEJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1,4-diazepan-1-yl)-2,5-dimethylhexanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,4-diazepan-1-yl)-2,5-dimethylhexanenitrile?
The IUPAC name of 2-(1,4-diazepan-1-yl)-2,5-dimethylhexanenitrile (CID 61006060) is 2-(1,4-diazepan-1-yl)-2,5-dimethylhexanenitrile.
What is the SMILES notation for 2-(1,4-diazepan-1-yl)-2,5-dimethylhexanenitrile?
The canonical SMILES for 2-(1,4-diazepan-1-yl)-2,5-dimethylhexanenitrile is CC(C)CCC(C)(C#N)N1CCCNCC1.
What is the InChIKey of 2-(1,4-diazepan-1-yl)-2,5-dimethylhexanenitrile?
The InChIKey is FOAZALMPDFHLEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N3/c1-12(2)5-6-13(3,11-14)16-9-4-7-15-8-10-16/h12,15H,4-10H2,1-3H3.
What are the key properties of 2-(1,4-diazepan-1-yl)-2,5-dimethylhexanenitrile?
2-(1,4-diazepan-1-yl)-2,5-dimethylhexanenitrile has a molecular weight of 223.36 g/mol, XLogP of 2.00, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,4-diazepan-1-yl)-2,5-dimethylhexanenitrile is sourced from PubChem (CID 61006060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).