About 8-(2-bromoanilino)-1,4-dioxaspiro[4.5]decane-8-carboxamide
8-(2-bromoanilino)-1,4-dioxaspiro[4.5]decane-8-carboxamide (PubChem CID 61006229) has the molecular formula C15H19BrN2O3
and a molecular weight of 355.23 g/mol. Its IUPAC name is 8-(2-bromoanilino)-1,4-dioxaspiro[4.5]decane-8-carboxamide.
Molecular Properties
| Compound Name | 8-(2-bromoanilino)-1,4-dioxaspiro[4.5]decane-8-carboxamide |
| PubChem CID | 61006229 |
| Molecular Formula | C15H19BrN2O3 |
| Molecular Weight | 355.23 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 8-(2-bromoanilino)-1,4-dioxaspiro[4.5]decane-8-carboxamide |
| SMILES | NC(=O)C1(Nc2ccccc2Br)CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C15H19BrN2O3/c16-11-3-1-2-4-12(11)18-14(13(17)19)5-7-15(8-6-14)20-9-10-21-15/h1-4,18H,5-10H2,(H2,17,19) |
| InChIKey | JFWPCAFDUOYQIV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.23 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-(2-bromoanilino)-1,4-dioxaspiro[4.5]decane-8-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2-bromoanilino)-1,4-dioxaspiro[4.5]decane-8-carboxamide?
The IUPAC name of 8-(2-bromoanilino)-1,4-dioxaspiro[4.5]decane-8-carboxamide (CID 61006229) is 8-(2-bromoanilino)-1,4-dioxaspiro[4.5]decane-8-carboxamide.
What is the SMILES notation for 8-(2-bromoanilino)-1,4-dioxaspiro[4.5]decane-8-carboxamide?
The canonical SMILES for 8-(2-bromoanilino)-1,4-dioxaspiro[4.5]decane-8-carboxamide is NC(=O)C1(Nc2ccccc2Br)CCC2(CC1)OCCO2.
What is the InChIKey of 8-(2-bromoanilino)-1,4-dioxaspiro[4.5]decane-8-carboxamide?
The InChIKey is JFWPCAFDUOYQIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19BrN2O3/c16-11-3-1-2-4-12(11)18-14(13(17)19)5-7-15(8-6-14)20-9-10-21-15/h1-4,18H,5-10H2,(H2,17,19).
What are the key properties of 8-(2-bromoanilino)-1,4-dioxaspiro[4.5]decane-8-carboxamide?
8-(2-bromoanilino)-1,4-dioxaspiro[4.5]decane-8-carboxamide has a molecular weight of 355.23 g/mol, XLogP of 2.40, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2-bromoanilino)-1,4-dioxaspiro[4.5]decane-8-carboxamide is sourced from PubChem (CID 61006229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).