C12H13ClN2O5 — CID 61006681
3-[(4-chloro-2-nitrobenzoyl)-ethylamino]propanoic acid (PubChem CID 61006681) has the molecular formula C12H13ClN2O5 and a molecular weight of 300.70 g/mol. Its IUPAC name is 3-[(4-chloro-2-nitrobenzoyl)-ethylamino]propanoic acid.
| Compound Name | 3-[(4-chloro-2-nitrobenzoyl)-ethylamino]propanoic acid |
|---|---|
| PubChem CID | 61006681 |
| Molecular Formula | C12H13ClN2O5 |
| Molecular Weight | 300.70 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 3-[(4-chloro-2-nitrobenzoyl)-ethylamino]propanoic acid |
| SMILES | CCN(CCC(=O)O)C(=O)c1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H13ClN2O5/c1-2-14(6-5-11(16)17)12(18)9-4-3-8(13)7-10(9)15(19)20/h3-4,7H,2,5-6H2,1H3,(H,16,17) |
| InChIKey | NVSKKJKKLHHZBU-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.70 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|