About 2-[1,2,4-oxadiazol-3-ylmethyl(propyl)amino]acetic acid
2-[1,2,4-oxadiazol-3-ylmethyl(propyl)amino]acetic acid (PubChem CID 61007246) has the molecular formula C8H13N3O3
and a molecular weight of 199.21 g/mol. Its IUPAC name is 2-[1,2,4-oxadiazol-3-ylmethyl(propyl)amino]acetic acid.
Molecular Properties
| Compound Name | 2-[1,2,4-oxadiazol-3-ylmethyl(propyl)amino]acetic acid |
| PubChem CID | 61007246 |
| Molecular Formula | C8H13N3O3 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 2-[1,2,4-oxadiazol-3-ylmethyl(propyl)amino]acetic acid |
| SMILES | CCCN(CC(=O)O)Cc1ncon1 |
| InChI | InChI=1S/C8H13N3O3/c1-2-3-11(5-8(12)13)4-7-9-6-14-10-7/h6H,2-5H2,1H3,(H,12,13) |
| InChIKey | QIQCPQYRMDMNRB-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[1,2,4-oxadiazol-3-ylmethyl(propyl)amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1,2,4-oxadiazol-3-ylmethyl(propyl)amino]acetic acid?
The IUPAC name of 2-[1,2,4-oxadiazol-3-ylmethyl(propyl)amino]acetic acid (CID 61007246) is 2-[1,2,4-oxadiazol-3-ylmethyl(propyl)amino]acetic acid.
What is the SMILES notation for 2-[1,2,4-oxadiazol-3-ylmethyl(propyl)amino]acetic acid?
The canonical SMILES for 2-[1,2,4-oxadiazol-3-ylmethyl(propyl)amino]acetic acid is CCCN(CC(=O)O)Cc1ncon1.
What is the InChIKey of 2-[1,2,4-oxadiazol-3-ylmethyl(propyl)amino]acetic acid?
The InChIKey is QIQCPQYRMDMNRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O3/c1-2-3-11(5-8(12)13)4-7-9-6-14-10-7/h6H,2-5H2,1H3,(H,12,13).
What are the key properties of 2-[1,2,4-oxadiazol-3-ylmethyl(propyl)amino]acetic acid?
2-[1,2,4-oxadiazol-3-ylmethyl(propyl)amino]acetic acid has a molecular weight of 199.21 g/mol, XLogP of 0.37, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1,2,4-oxadiazol-3-ylmethyl(propyl)amino]acetic acid is sourced from PubChem (CID 61007246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).