About methyl 2-[1-(2,4-dioxo-1H-pyrimidine-5-carbonyl)piperidin-2-yl]acetate
methyl 2-[1-(2,4-dioxo-1H-pyrimidine-5-carbonyl)piperidin-2-yl]acetate (PubChem CID 61010258) has the molecular formula C13H17N3O5
and a molecular weight of 295.29 g/mol. Its IUPAC name is methyl 2-[1-(2,4-dioxo-1H-pyrimidine-5-carbonyl)piperidin-2-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[1-(2,4-dioxo-1H-pyrimidine-5-carbonyl)piperidin-2-yl]acetate |
| PubChem CID | 61010258 |
| Molecular Formula | C13H17N3O5 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | methyl 2-[1-(2,4-dioxo-1H-pyrimidine-5-carbonyl)piperidin-2-yl]acetate |
| SMILES | COC(=O)CC1CCCCN1C(=O)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H17N3O5/c1-21-10(17)6-8-4-2-3-5-16(8)12(19)9-7-14-13(20)15-11(9)18/h7-8H,2-6H2,1H3,(H2,14,15,18,20) |
| InChIKey | BHSGWYVMAKRYQA-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 112.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-[1-(2,4-dioxo-1H-pyrimidine-5-carbonyl)piperidin-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[1-(2,4-dioxo-1H-pyrimidine-5-carbonyl)piperidin-2-yl]acetate?
The IUPAC name of methyl 2-[1-(2,4-dioxo-1H-pyrimidine-5-carbonyl)piperidin-2-yl]acetate (CID 61010258) is methyl 2-[1-(2,4-dioxo-1H-pyrimidine-5-carbonyl)piperidin-2-yl]acetate.
What is the SMILES notation for methyl 2-[1-(2,4-dioxo-1H-pyrimidine-5-carbonyl)piperidin-2-yl]acetate?
The canonical SMILES for methyl 2-[1-(2,4-dioxo-1H-pyrimidine-5-carbonyl)piperidin-2-yl]acetate is COC(=O)CC1CCCCN1C(=O)c1c[nH]c(=O)[nH]c1=O.
What is the InChIKey of methyl 2-[1-(2,4-dioxo-1H-pyrimidine-5-carbonyl)piperidin-2-yl]acetate?
The InChIKey is BHSGWYVMAKRYQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O5/c1-21-10(17)6-8-4-2-3-5-16(8)12(19)9-7-14-13(20)15-11(9)18/h7-8H,2-6H2,1H3,(H2,14,15,18,20).
What are the key properties of methyl 2-[1-(2,4-dioxo-1H-pyrimidine-5-carbonyl)piperidin-2-yl]acetate?
methyl 2-[1-(2,4-dioxo-1H-pyrimidine-5-carbonyl)piperidin-2-yl]acetate has a molecular weight of 295.29 g/mol, XLogP of -0.38, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[1-(2,4-dioxo-1H-pyrimidine-5-carbonyl)piperidin-2-yl]acetate is sourced from PubChem (CID 61010258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).