C15H19IN2O3 — CID 61010407
2-[1-[2-(3-iodoanilino)-2-oxoethyl]piperidin-2-yl]acetic acid (PubChem CID 61010407) has the molecular formula C15H19IN2O3 and a molecular weight of 402.23 g/mol. Its IUPAC name is 2-[1-[2-(3-iodoanilino)-2-oxoethyl]piperidin-2-yl]acetic acid.
| Compound Name | 2-[1-[2-(3-iodoanilino)-2-oxoethyl]piperidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 61010407 |
| Molecular Formula | C15H19IN2O3 |
| Molecular Weight | 402.23 g/mol |
| Exact Mass | 402.04 |
| IUPAC Name | 2-[1-[2-(3-iodoanilino)-2-oxoethyl]piperidin-2-yl]acetic acid |
| SMILES | O=C(O)CC1CCCCN1CC(=O)Nc1cccc(I)c1 |
| InChI | InChI=1S/C15H19IN2O3/c16-11-4-3-5-12(8-11)17-14(19)10-18-7-2-1-6-13(18)9-15(20)21/h3-5,8,13H,1-2,6-7,9-10H2,(H,17,19)(H,20,21) |
| InChIKey | CAOQOIUMGREETJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.23 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|