About methyl 3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl-ethylamino]propanoate
methyl 3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl-ethylamino]propanoate (PubChem CID 61010503) has the molecular formula C10H15N3O6S
and a molecular weight of 305.31 g/mol. Its IUPAC name is methyl 3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl-ethylamino]propanoate.
Molecular Properties
| Compound Name | methyl 3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl-ethylamino]propanoate |
| PubChem CID | 61010503 |
| Molecular Formula | C10H15N3O6S |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | methyl 3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl-ethylamino]propanoate |
| SMILES | CCN(CCC(=O)OC)S(=O)(=O)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H15N3O6S/c1-3-13(5-4-8(14)19-2)20(17,18)7-6-11-10(16)12-9(7)15/h6H,3-5H2,1-2H3,(H2,11,12,15,16) |
| InChIKey | RRGVQHLSJGLPII-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 129.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl-ethylamino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl-ethylamino]propanoate?
The IUPAC name of methyl 3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl-ethylamino]propanoate (CID 61010503) is methyl 3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl-ethylamino]propanoate.
What is the SMILES notation for methyl 3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl-ethylamino]propanoate?
The canonical SMILES for methyl 3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl-ethylamino]propanoate is CCN(CCC(=O)OC)S(=O)(=O)c1c[nH]c(=O)[nH]c1=O.
What is the InChIKey of methyl 3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl-ethylamino]propanoate?
The InChIKey is RRGVQHLSJGLPII-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O6S/c1-3-13(5-4-8(14)19-2)20(17,18)7-6-11-10(16)12-9(7)15/h6H,3-5H2,1-2H3,(H2,11,12,15,16).
What are the key properties of methyl 3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl-ethylamino]propanoate?
methyl 3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl-ethylamino]propanoate has a molecular weight of 305.31 g/mol, XLogP of -1.36, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl-ethylamino]propanoate is sourced from PubChem (CID 61010503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).