methyl 2-[1-(1,1-dioxothiolane-3-carbonyl)piperidin-2-yl]acetate

C13H21NO5S — CID 61010521

IUPACmethyl 2-[1-(1,1-dioxothiolane-3-carbonyl)piperidin-2-yl]acetate
SMILESCOC(=O)CC1CCCCN1C(=O)C1CCS(=O)(=O)C1
InChIInChI=1S/C13H21NO5S/c1-19-12(15)8-11-4-2-3-6-14(11)13(16)10-5-7-20(17,18)9-10/h10-11H,2-9H2,1H3
InChIKeyMMRBFXVSMHTSLS-UHFFFAOYSA-N
MW303.38 g/mol
LogP0.37
Rot. Bonds3

About methyl 2-[1-(1,1-dioxothiolane-3-carbonyl)piperidin-2-yl]acetate

methyl 2-[1-(1,1-dioxothiolane-3-carbonyl)piperidin-2-yl]acetate (PubChem CID 61010521) has the molecular formula C13H21NO5S and a molecular weight of 303.38 g/mol. Its IUPAC name is methyl 2-[1-(1,1-dioxothiolane-3-carbonyl)piperidin-2-yl]acetate.

Molecular Properties

Compound Namemethyl 2-[1-(1,1-dioxothiolane-3-carbonyl)piperidin-2-yl]acetate
PubChem CID61010521
Molecular FormulaC13H21NO5S
Molecular Weight303.38 g/mol
Exact Mass303.11
IUPAC Namemethyl 2-[1-(1,1-dioxothiolane-3-carbonyl)piperidin-2-yl]acetate
SMILESCOC(=O)CC1CCCCN1C(=O)C1CCS(=O)(=O)C1
InChIInChI=1S/C13H21NO5S/c1-19-12(15)8-11-4-2-3-6-14(11)13(16)10-5-7-20(17,18)9-10/h10-11H,2-9H2,1H3
InChIKeyMMRBFXVSMHTSLS-UHFFFAOYSA-N
XLogP0.37
TPSA80.75 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500303.38
LogP ≤ 50.37
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 2-[1-(1,1-dioxothiolane-3-carbonyl)piperidin-2-yl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[1-(1,1-dioxothiolane-3-carbonyl)piperidin-2-yl]acetate?
The IUPAC name of methyl 2-[1-(1,1-dioxothiolane-3-carbonyl)piperidin-2-yl]acetate (CID 61010521) is methyl 2-[1-(1,1-dioxothiolane-3-carbonyl)piperidin-2-yl]acetate.
What is the SMILES notation for methyl 2-[1-(1,1-dioxothiolane-3-carbonyl)piperidin-2-yl]acetate?
The canonical SMILES for methyl 2-[1-(1,1-dioxothiolane-3-carbonyl)piperidin-2-yl]acetate is COC(=O)CC1CCCCN1C(=O)C1CCS(=O)(=O)C1.
What is the InChIKey of methyl 2-[1-(1,1-dioxothiolane-3-carbonyl)piperidin-2-yl]acetate?
The InChIKey is MMRBFXVSMHTSLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO5S/c1-19-12(15)8-11-4-2-3-6-14(11)13(16)10-5-7-20(17,18)9-10/h10-11H,2-9H2,1H3.
What are the key properties of methyl 2-[1-(1,1-dioxothiolane-3-carbonyl)piperidin-2-yl]acetate?
methyl 2-[1-(1,1-dioxothiolane-3-carbonyl)piperidin-2-yl]acetate has a molecular weight of 303.38 g/mol, XLogP of 0.37, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[1-(1,1-dioxothiolane-3-carbonyl)piperidin-2-yl]acetate is sourced from PubChem (CID 61010521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).