2-[ethyl-[(2-oxo-1,3-oxazolidin-5-yl)methyl]amino]acetic acid

C8H14N2O4 — CID 61011469

IUPAC2-[ethyl-[(2-oxo-1,3-oxazolidin-5-yl)methyl]amino]acetic acid
SMILESCCN(CC(=O)O)CC1CNC(=O)O1
InChIInChI=1S/C8H14N2O4/c1-2-10(5-7(11)12)4-6-3-9-8(13)14-6/h6H,2-5H2,1H3,(H,9,13)(H,11,12)
InChIKeyCWTZAOLPIRKLQJ-UHFFFAOYSA-N
MW202.21 g/mol
LogP-0.50
Rot. Bonds5

About 2-[ethyl-[(2-oxo-1,3-oxazolidin-5-yl)methyl]amino]acetic acid

2-[ethyl-[(2-oxo-1,3-oxazolidin-5-yl)methyl]amino]acetic acid (PubChem CID 61011469) has the molecular formula C8H14N2O4 and a molecular weight of 202.21 g/mol. Its IUPAC name is 2-[ethyl-[(2-oxo-1,3-oxazolidin-5-yl)methyl]amino]acetic acid.

Molecular Properties

Compound Name2-[ethyl-[(2-oxo-1,3-oxazolidin-5-yl)methyl]amino]acetic acid
PubChem CID61011469
Molecular FormulaC8H14N2O4
Molecular Weight202.21 g/mol
Exact Mass202.10
IUPAC Name2-[ethyl-[(2-oxo-1,3-oxazolidin-5-yl)methyl]amino]acetic acid
SMILESCCN(CC(=O)O)CC1CNC(=O)O1
InChIInChI=1S/C8H14N2O4/c1-2-10(5-7(11)12)4-6-3-9-8(13)14-6/h6H,2-5H2,1H3,(H,9,13)(H,11,12)
InChIKeyCWTZAOLPIRKLQJ-UHFFFAOYSA-N
XLogP-0.50
TPSA78.87 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500202.21
LogP ≤ 5-0.50
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-[ethyl-[(2-oxo-1,3-oxazolidin-5-yl)methyl]amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[ethyl-[(2-oxo-1,3-oxazolidin-5-yl)methyl]amino]acetic acid?
The IUPAC name of 2-[ethyl-[(2-oxo-1,3-oxazolidin-5-yl)methyl]amino]acetic acid (CID 61011469) is 2-[ethyl-[(2-oxo-1,3-oxazolidin-5-yl)methyl]amino]acetic acid.
What is the SMILES notation for 2-[ethyl-[(2-oxo-1,3-oxazolidin-5-yl)methyl]amino]acetic acid?
The canonical SMILES for 2-[ethyl-[(2-oxo-1,3-oxazolidin-5-yl)methyl]amino]acetic acid is CCN(CC(=O)O)CC1CNC(=O)O1.
What is the InChIKey of 2-[ethyl-[(2-oxo-1,3-oxazolidin-5-yl)methyl]amino]acetic acid?
The InChIKey is CWTZAOLPIRKLQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O4/c1-2-10(5-7(11)12)4-6-3-9-8(13)14-6/h6H,2-5H2,1H3,(H,9,13)(H,11,12).
What are the key properties of 2-[ethyl-[(2-oxo-1,3-oxazolidin-5-yl)methyl]amino]acetic acid?
2-[ethyl-[(2-oxo-1,3-oxazolidin-5-yl)methyl]amino]acetic acid has a molecular weight of 202.21 g/mol, XLogP of -0.50, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[ethyl-[(2-oxo-1,3-oxazolidin-5-yl)methyl]amino]acetic acid is sourced from PubChem (CID 61011469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).