C9H10BrNO3S — CID 61011483
4-[(5-bromothiophen-2-yl)methylamino]-4-oxobutanoic acid (PubChem CID 61011483) has the molecular formula C9H10BrNO3S and a molecular weight of 292.15 g/mol. Its IUPAC name is 4-[(5-bromothiophen-2-yl)methylamino]-4-oxobutanoic acid.
| Compound Name | 4-[(5-bromothiophen-2-yl)methylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 61011483 |
| Molecular Formula | C9H10BrNO3S |
| Molecular Weight | 292.15 g/mol |
| Exact Mass | 290.96 |
| IUPAC Name | 4-[(5-bromothiophen-2-yl)methylamino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)NCc1ccc(Br)s1 |
| InChI | InChI=1S/C9H10BrNO3S/c10-7-2-1-6(15-7)5-11-8(12)3-4-9(13)14/h1-2H,3-5H2,(H,11,12)(H,13,14) |
| InChIKey | FSEQCBFOELYWNX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.15 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |