2-[(4-methyl-1,3-thiazole-5-carbonyl)-propylamino]acetic acid

C10H14N2O3S — CID 61011678

IUPAC2-[(4-methyl-1,3-thiazole-5-carbonyl)-propylamino]acetic acid
SMILESCCCN(CC(=O)O)C(=O)c1scnc1C
InChIInChI=1S/C10H14N2O3S/c1-3-4-12(5-8(13)14)10(15)9-7(2)11-6-16-9/h6H,3-5H2,1-2H3,(H,13,14)
InChIKeyHQWZHHNWBYAVOH-UHFFFAOYSA-N
MW242.30 g/mol
LogP1.39
Rot. Bonds5

About 2-[(4-methyl-1,3-thiazole-5-carbonyl)-propylamino]acetic acid

2-[(4-methyl-1,3-thiazole-5-carbonyl)-propylamino]acetic acid (PubChem CID 61011678) has the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. Its IUPAC name is 2-[(4-methyl-1,3-thiazole-5-carbonyl)-propylamino]acetic acid.

Molecular Properties

Compound Name2-[(4-methyl-1,3-thiazole-5-carbonyl)-propylamino]acetic acid
PubChem CID61011678
Molecular FormulaC10H14N2O3S
Molecular Weight242.30 g/mol
Exact Mass242.07
IUPAC Name2-[(4-methyl-1,3-thiazole-5-carbonyl)-propylamino]acetic acid
SMILESCCCN(CC(=O)O)C(=O)c1scnc1C
InChIInChI=1S/C10H14N2O3S/c1-3-4-12(5-8(13)14)10(15)9-7(2)11-6-16-9/h6H,3-5H2,1-2H3,(H,13,14)
InChIKeyHQWZHHNWBYAVOH-UHFFFAOYSA-N
XLogP1.39
TPSA70.50 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.30
LogP ≤ 51.39
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[(4-methyl-1,3-thiazole-5-carbonyl)-propylamino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(4-methyl-1,3-thiazole-5-carbonyl)-propylamino]acetic acid?
The IUPAC name of 2-[(4-methyl-1,3-thiazole-5-carbonyl)-propylamino]acetic acid (CID 61011678) is 2-[(4-methyl-1,3-thiazole-5-carbonyl)-propylamino]acetic acid.
What is the SMILES notation for 2-[(4-methyl-1,3-thiazole-5-carbonyl)-propylamino]acetic acid?
The canonical SMILES for 2-[(4-methyl-1,3-thiazole-5-carbonyl)-propylamino]acetic acid is CCCN(CC(=O)O)C(=O)c1scnc1C.
What is the InChIKey of 2-[(4-methyl-1,3-thiazole-5-carbonyl)-propylamino]acetic acid?
The InChIKey is HQWZHHNWBYAVOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O3S/c1-3-4-12(5-8(13)14)10(15)9-7(2)11-6-16-9/h6H,3-5H2,1-2H3,(H,13,14).
What are the key properties of 2-[(4-methyl-1,3-thiazole-5-carbonyl)-propylamino]acetic acid?
2-[(4-methyl-1,3-thiazole-5-carbonyl)-propylamino]acetic acid has a molecular weight of 242.30 g/mol, XLogP of 1.39, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-methyl-1,3-thiazole-5-carbonyl)-propylamino]acetic acid is sourced from PubChem (CID 61011678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).