C15H19F2NO3 — CID 61011840
ethyl 2-[3-(3,4-difluorophenyl)propanoyl-ethylamino]acetate (PubChem CID 61011840) has the molecular formula C15H19F2NO3 and a molecular weight of 299.32 g/mol. Its IUPAC name is ethyl 2-[3-(3,4-difluorophenyl)propanoyl-ethylamino]acetate.
| Compound Name | ethyl 2-[3-(3,4-difluorophenyl)propanoyl-ethylamino]acetate |
|---|---|
| PubChem CID | 61011840 |
| Molecular Formula | C15H19F2NO3 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | ethyl 2-[3-(3,4-difluorophenyl)propanoyl-ethylamino]acetate |
| SMILES | CCOC(=O)CN(CC)C(=O)CCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H19F2NO3/c1-3-18(10-15(20)21-4-2)14(19)8-6-11-5-7-12(16)13(17)9-11/h5,7,9H,3-4,6,8,10H2,1-2H3 |
| InChIKey | OQQBBPDKGLGYCR-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |