C13H14F3NO3S — CID 61012642
2-[propyl-[4-(trifluoromethylsulfanyl)benzoyl]amino]acetic acid (PubChem CID 61012642) has the molecular formula C13H14F3NO3S and a molecular weight of 321.32 g/mol. Its IUPAC name is 2-[propyl-[4-(trifluoromethylsulfanyl)benzoyl]amino]acetic acid.
| Compound Name | 2-[propyl-[4-(trifluoromethylsulfanyl)benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 61012642 |
| Molecular Formula | C13H14F3NO3S |
| Molecular Weight | 321.32 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 2-[propyl-[4-(trifluoromethylsulfanyl)benzoyl]amino]acetic acid |
| SMILES | CCCN(CC(=O)O)C(=O)c1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H14F3NO3S/c1-2-7-17(8-11(18)19)12(20)9-3-5-10(6-4-9)21-13(14,15)16/h3-6H,2,7-8H2,1H3,(H,18,19) |
| InChIKey | JXPNQOLRZLZREN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.32 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |