About 7-nitro-1-oxido-1,2,4-benzotriazin-1-ium-3-amine
7-nitro-1-oxido-1,2,4-benzotriazin-1-ium-3-amine (PubChem CID 610127) has the molecular formula C7H5N5O3
and a molecular weight of 207.15 g/mol. Its IUPAC name is 7-nitro-1-oxido-1,2,4-benzotriazin-1-ium-3-amine.
Molecular Properties
| Compound Name | 7-nitro-1-oxido-1,2,4-benzotriazin-1-ium-3-amine |
| PubChem CID | 610127 |
| Molecular Formula | C7H5N5O3 |
| Molecular Weight | 207.15 g/mol |
| Exact Mass | 207.04 |
| IUPAC Name | 7-nitro-1-oxido-1,2,4-benzotriazin-1-ium-3-amine |
| SMILES | Nc1nc2ccc([N+](=O)[O-])cc2[n+]([O-])n1 |
| InChI | InChI=1S/C7H5N5O3/c8-7-9-5-2-1-4(12(14)15)3-6(5)11(13)10-7/h1-3H,(H2,8,9,10) |
| InChIKey | PHHMEVWJJAMNFZ-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.15 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 7-nitro-1-oxido-1,2,4-benzotriazin-1-ium-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-nitro-1-oxido-1,2,4-benzotriazin-1-ium-3-amine?
The IUPAC name of 7-nitro-1-oxido-1,2,4-benzotriazin-1-ium-3-amine (CID 610127) is 7-nitro-1-oxido-1,2,4-benzotriazin-1-ium-3-amine.
What is the SMILES notation for 7-nitro-1-oxido-1,2,4-benzotriazin-1-ium-3-amine?
The canonical SMILES for 7-nitro-1-oxido-1,2,4-benzotriazin-1-ium-3-amine is Nc1nc2ccc([N+](=O)[O-])cc2[n+]([O-])n1.
What is the InChIKey of 7-nitro-1-oxido-1,2,4-benzotriazin-1-ium-3-amine?
The InChIKey is PHHMEVWJJAMNFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N5O3/c8-7-9-5-2-1-4(12(14)15)3-6(5)11(13)10-7/h1-3H,(H2,8,9,10).
What are the key properties of 7-nitro-1-oxido-1,2,4-benzotriazin-1-ium-3-amine?
7-nitro-1-oxido-1,2,4-benzotriazin-1-ium-3-amine has a molecular weight of 207.15 g/mol, XLogP of -0.25, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-nitro-1-oxido-1,2,4-benzotriazin-1-ium-3-amine is sourced from PubChem (CID 610127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).