2-[2,3-dihydro-1-benzofuran-5-carbonyl(propyl)amino]acetic acid

C14H17NO4 — CID 61013012

IUPAC2-[2,3-dihydro-1-benzofuran-5-carbonyl(propyl)amino]acetic acid
SMILESCCCN(CC(=O)O)C(=O)c1ccc2c(c1)CCO2
InChIInChI=1S/C14H17NO4/c1-2-6-15(9-13(16)17)14(18)11-3-4-12-10(8-11)5-7-19-12/h3-4,8H,2,5-7,9H2,1H3,(H,16,17)
InChIKeyKJQQCFKFUFAREM-UHFFFAOYSA-N
MW263.29 g/mol
LogP1.56
Rot. Bonds5

About 2-[2,3-dihydro-1-benzofuran-5-carbonyl(propyl)amino]acetic acid

2-[2,3-dihydro-1-benzofuran-5-carbonyl(propyl)amino]acetic acid (PubChem CID 61013012) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is 2-[2,3-dihydro-1-benzofuran-5-carbonyl(propyl)amino]acetic acid.

Molecular Properties

Compound Name2-[2,3-dihydro-1-benzofuran-5-carbonyl(propyl)amino]acetic acid
PubChem CID61013012
Molecular FormulaC14H17NO4
Molecular Weight263.29 g/mol
Exact Mass263.12
IUPAC Name2-[2,3-dihydro-1-benzofuran-5-carbonyl(propyl)amino]acetic acid
SMILESCCCN(CC(=O)O)C(=O)c1ccc2c(c1)CCO2
InChIInChI=1S/C14H17NO4/c1-2-6-15(9-13(16)17)14(18)11-3-4-12-10(8-11)5-7-19-12/h3-4,8H,2,5-7,9H2,1H3,(H,16,17)
InChIKeyKJQQCFKFUFAREM-UHFFFAOYSA-N
XLogP1.56
TPSA66.84 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.29
LogP ≤ 51.56
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[2,3-dihydro-1-benzofuran-5-carbonyl(propyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2,3-dihydro-1-benzofuran-5-carbonyl(propyl)amino]acetic acid?
The IUPAC name of 2-[2,3-dihydro-1-benzofuran-5-carbonyl(propyl)amino]acetic acid (CID 61013012) is 2-[2,3-dihydro-1-benzofuran-5-carbonyl(propyl)amino]acetic acid.
What is the SMILES notation for 2-[2,3-dihydro-1-benzofuran-5-carbonyl(propyl)amino]acetic acid?
The canonical SMILES for 2-[2,3-dihydro-1-benzofuran-5-carbonyl(propyl)amino]acetic acid is CCCN(CC(=O)O)C(=O)c1ccc2c(c1)CCO2.
What is the InChIKey of 2-[2,3-dihydro-1-benzofuran-5-carbonyl(propyl)amino]acetic acid?
The InChIKey is KJQQCFKFUFAREM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO4/c1-2-6-15(9-13(16)17)14(18)11-3-4-12-10(8-11)5-7-19-12/h3-4,8H,2,5-7,9H2,1H3,(H,16,17).
What are the key properties of 2-[2,3-dihydro-1-benzofuran-5-carbonyl(propyl)amino]acetic acid?
2-[2,3-dihydro-1-benzofuran-5-carbonyl(propyl)amino]acetic acid has a molecular weight of 263.29 g/mol, XLogP of 1.56, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,3-dihydro-1-benzofuran-5-carbonyl(propyl)amino]acetic acid is sourced from PubChem (CID 61013012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).