C17H24BrFN2 — CID 61013264
1-(3-bromo-4-fluorophenyl)-N-[(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)methyl]ethanamine (PubChem CID 61013264) has the molecular formula C17H24BrFN2 and a molecular weight of 355.30 g/mol. Its IUPAC name is 1-(3-bromo-4-fluorophenyl)-N-[(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)methyl]ethanamine.
| Compound Name | 1-(3-bromo-4-fluorophenyl)-N-[(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 61013264 |
| Molecular Formula | C17H24BrFN2 |
| Molecular Weight | 355.30 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 1-(3-bromo-4-fluorophenyl)-N-[(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)methyl]ethanamine |
| SMILES | CC(NCC1CC2CCC(C1)N2C)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C17H24BrFN2/c1-11(13-3-6-17(19)16(18)9-13)20-10-12-7-14-4-5-15(8-12)21(14)2/h3,6,9,11-12,14-15,20H,4-5,7-8,10H2,1-2H3 |
| InChIKey | BQBCUSHMMWUTPL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.30 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |