C10H18N4O2 — CID 61013892
6-amino-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]hexanamide (PubChem CID 61013892) has the molecular formula C10H18N4O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is 6-amino-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]hexanamide.
| Compound Name | 6-amino-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]hexanamide |
|---|---|
| PubChem CID | 61013892 |
| Molecular Formula | C10H18N4O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 6-amino-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]hexanamide |
| SMILES | Cc1noc(CNC(=O)CCCCCN)n1 |
| InChI | InChI=1S/C10H18N4O2/c1-8-13-10(16-14-8)7-12-9(15)5-3-2-4-6-11/h2-7,11H2,1H3,(H,12,15) |
| InChIKey | CODHSWJTPGKXJM-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|