About N'-benzyl-N'-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)ethane-1,2-diamine
N'-benzyl-N'-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)ethane-1,2-diamine (PubChem CID 61013957) has the molecular formula C15H18N6
and a molecular weight of 282.35 g/mol. Its IUPAC name is N'-benzyl-N'-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-benzyl-N'-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)ethane-1,2-diamine |
| PubChem CID | 61013957 |
| Molecular Formula | C15H18N6 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | N'-benzyl-N'-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)ethane-1,2-diamine |
| SMILES | Cn1ncc2c(N(CCN)Cc3ccccc3)ncnc21 |
| InChI | InChI=1S/C15H18N6/c1-20-14-13(9-19-20)15(18-11-17-14)21(8-7-16)10-12-5-3-2-4-6-12/h2-6,9,11H,7-8,10,16H2,1H3 |
| InChIKey | LSRALYYQQLDOBH-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N'-benzyl-N'-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-benzyl-N'-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)ethane-1,2-diamine?
The IUPAC name of N'-benzyl-N'-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)ethane-1,2-diamine (CID 61013957) is N'-benzyl-N'-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)ethane-1,2-diamine.
What is the SMILES notation for N'-benzyl-N'-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)ethane-1,2-diamine?
The canonical SMILES for N'-benzyl-N'-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)ethane-1,2-diamine is Cn1ncc2c(N(CCN)Cc3ccccc3)ncnc21.
What is the InChIKey of N'-benzyl-N'-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)ethane-1,2-diamine?
The InChIKey is LSRALYYQQLDOBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N6/c1-20-14-13(9-19-20)15(18-11-17-14)21(8-7-16)10-12-5-3-2-4-6-12/h2-6,9,11H,7-8,10,16H2,1H3.
What are the key properties of N'-benzyl-N'-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)ethane-1,2-diamine?
N'-benzyl-N'-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)ethane-1,2-diamine has a molecular weight of 282.35 g/mol, XLogP of 1.33, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-benzyl-N'-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)ethane-1,2-diamine is sourced from PubChem (CID 61013957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).