C15H17Cl2NO3 — CID 61014510
2-cyclohexyl-2-[(3,5-dichlorobenzoyl)amino]acetic acid (PubChem CID 61014510) has the molecular formula C15H17Cl2NO3 and a molecular weight of 330.21 g/mol. Its IUPAC name is 2-cyclohexyl-2-[(3,5-dichlorobenzoyl)amino]acetic acid.
| Compound Name | 2-cyclohexyl-2-[(3,5-dichlorobenzoyl)amino]acetic acid |
|---|---|
| PubChem CID | 61014510 |
| Molecular Formula | C15H17Cl2NO3 |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 2-cyclohexyl-2-[(3,5-dichlorobenzoyl)amino]acetic acid |
| SMILES | O=C(NC(C(=O)O)C1CCCCC1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C15H17Cl2NO3/c16-11-6-10(7-12(17)8-11)14(19)18-13(15(20)21)9-4-2-1-3-5-9/h6-9,13H,1-5H2,(H,18,19)(H,20,21) |
| InChIKey | RYWPJYNOICUVCZ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |