2-cyclohexyl-2-[(3,5-dichlorobenzoyl)amino]acetic acid

C15H17Cl2NO3 — CID 61014510

IUPAC2-cyclohexyl-2-[(3,5-dichlorobenzoyl)amino]acetic acid
SMILESO=C(NC(C(=O)O)C1CCCCC1)c1cc(Cl)cc(Cl)c1
InChIInChI=1S/C15H17Cl2NO3/c16-11-6-10(7-12(17)8-11)14(19)18-13(15(20)21)9-4-2-1-3-5-9/h6-9,13H,1-5H2,(H,18,19)(H,20,21)
InChIKeyRYWPJYNOICUVCZ-UHFFFAOYSA-N
MW330.21 g/mol
LogP3.76
Rot. Bonds4

About 2-cyclohexyl-2-[(3,5-dichlorobenzoyl)amino]acetic acid

2-cyclohexyl-2-[(3,5-dichlorobenzoyl)amino]acetic acid (PubChem CID 61014510) has the molecular formula C15H17Cl2NO3 and a molecular weight of 330.21 g/mol. Its IUPAC name is 2-cyclohexyl-2-[(3,5-dichlorobenzoyl)amino]acetic acid.

Molecular Properties

Compound Name2-cyclohexyl-2-[(3,5-dichlorobenzoyl)amino]acetic acid
PubChem CID61014510
Molecular FormulaC15H17Cl2NO3
Molecular Weight330.21 g/mol
Exact Mass329.06
IUPAC Name2-cyclohexyl-2-[(3,5-dichlorobenzoyl)amino]acetic acid
SMILESO=C(NC(C(=O)O)C1CCCCC1)c1cc(Cl)cc(Cl)c1
InChIInChI=1S/C15H17Cl2NO3/c16-11-6-10(7-12(17)8-11)14(19)18-13(15(20)21)9-4-2-1-3-5-9/h6-9,13H,1-5H2,(H,18,19)(H,20,21)
InChIKeyRYWPJYNOICUVCZ-UHFFFAOYSA-N
XLogP3.76
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500330.21
LogP ≤ 53.76
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-cyclohexyl-2-[(3,5-dichlorobenzoyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-cyclohexyl-2-[(3,5-dichlorobenzoyl)amino]acetic acid?
The IUPAC name of 2-cyclohexyl-2-[(3,5-dichlorobenzoyl)amino]acetic acid (CID 61014510) is 2-cyclohexyl-2-[(3,5-dichlorobenzoyl)amino]acetic acid.
What is the SMILES notation for 2-cyclohexyl-2-[(3,5-dichlorobenzoyl)amino]acetic acid?
The canonical SMILES for 2-cyclohexyl-2-[(3,5-dichlorobenzoyl)amino]acetic acid is O=C(NC(C(=O)O)C1CCCCC1)c1cc(Cl)cc(Cl)c1.
What is the InChIKey of 2-cyclohexyl-2-[(3,5-dichlorobenzoyl)amino]acetic acid?
The InChIKey is RYWPJYNOICUVCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17Cl2NO3/c16-11-6-10(7-12(17)8-11)14(19)18-13(15(20)21)9-4-2-1-3-5-9/h6-9,13H,1-5H2,(H,18,19)(H,20,21).
What are the key properties of 2-cyclohexyl-2-[(3,5-dichlorobenzoyl)amino]acetic acid?
2-cyclohexyl-2-[(3,5-dichlorobenzoyl)amino]acetic acid has a molecular weight of 330.21 g/mol, XLogP of 3.76, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-2-[(3,5-dichlorobenzoyl)amino]acetic acid is sourced from PubChem (CID 61014510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).