C13H19NO5S — CID 61014839
N-[4-ethoxy-3-(hydroxymethyl)phenyl]-3-methylsulfonylpropanamide (PubChem CID 61014839) has the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. Its IUPAC name is N-[4-ethoxy-3-(hydroxymethyl)phenyl]-3-methylsulfonylpropanamide.
| Compound Name | N-[4-ethoxy-3-(hydroxymethyl)phenyl]-3-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 61014839 |
| Molecular Formula | C13H19NO5S |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | N-[4-ethoxy-3-(hydroxymethyl)phenyl]-3-methylsulfonylpropanamide |
| SMILES | CCOc1ccc(NC(=O)CCS(C)(=O)=O)cc1CO |
| InChI | InChI=1S/C13H19NO5S/c1-3-19-12-5-4-11(8-10(12)9-15)14-13(16)6-7-20(2,17)18/h4-5,8,15H,3,6-7,9H2,1-2H3,(H,14,16) |
| InChIKey | ORQUXASFRYEGBX-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |