About N-ethyl-N-[3-[(1-ethyl-2,5-dioxopyrrolidin-3-yl)amino]propyl]methanesulfonamide
N-ethyl-N-[3-[(1-ethyl-2,5-dioxopyrrolidin-3-yl)amino]propyl]methanesulfonamide (PubChem CID 61015280) has the molecular formula C12H23N3O4S
and a molecular weight of 305.40 g/mol. Its IUPAC name is N-ethyl-N-[3-[(1-ethyl-2,5-dioxopyrrolidin-3-yl)amino]propyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-ethyl-N-[3-[(1-ethyl-2,5-dioxopyrrolidin-3-yl)amino]propyl]methanesulfonamide |
| PubChem CID | 61015280 |
| Molecular Formula | C12H23N3O4S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | N-ethyl-N-[3-[(1-ethyl-2,5-dioxopyrrolidin-3-yl)amino]propyl]methanesulfonamide |
| SMILES | CCN1C(=O)CC(NCCCN(CC)S(C)(=O)=O)C1=O |
| InChI | InChI=1S/C12H23N3O4S/c1-4-14(20(3,18)19)8-6-7-13-10-9-11(16)15(5-2)12(10)17/h10,13H,4-9H2,1-3H3 |
| InChIKey | FIKBXQPWZXIMJK-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N-[3-[(1-ethyl-2,5-dioxopyrrolidin-3-yl)amino]propyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-[3-[(1-ethyl-2,5-dioxopyrrolidin-3-yl)amino]propyl]methanesulfonamide?
The IUPAC name of N-ethyl-N-[3-[(1-ethyl-2,5-dioxopyrrolidin-3-yl)amino]propyl]methanesulfonamide (CID 61015280) is N-ethyl-N-[3-[(1-ethyl-2,5-dioxopyrrolidin-3-yl)amino]propyl]methanesulfonamide.
What is the SMILES notation for N-ethyl-N-[3-[(1-ethyl-2,5-dioxopyrrolidin-3-yl)amino]propyl]methanesulfonamide?
The canonical SMILES for N-ethyl-N-[3-[(1-ethyl-2,5-dioxopyrrolidin-3-yl)amino]propyl]methanesulfonamide is CCN1C(=O)CC(NCCCN(CC)S(C)(=O)=O)C1=O.
What is the InChIKey of N-ethyl-N-[3-[(1-ethyl-2,5-dioxopyrrolidin-3-yl)amino]propyl]methanesulfonamide?
The InChIKey is FIKBXQPWZXIMJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3O4S/c1-4-14(20(3,18)19)8-6-7-13-10-9-11(16)15(5-2)12(10)17/h10,13H,4-9H2,1-3H3.
What are the key properties of N-ethyl-N-[3-[(1-ethyl-2,5-dioxopyrrolidin-3-yl)amino]propyl]methanesulfonamide?
N-ethyl-N-[3-[(1-ethyl-2,5-dioxopyrrolidin-3-yl)amino]propyl]methanesulfonamide has a molecular weight of 305.40 g/mol, XLogP of -0.61, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-[3-[(1-ethyl-2,5-dioxopyrrolidin-3-yl)amino]propyl]methanesulfonamide is sourced from PubChem (CID 61015280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).