About 6-iodo-7H-purin-2-amine
6-iodo-7H-purin-2-amine (PubChem CID 6101575) has the molecular formula C5H4IN5
and a molecular weight of 261.03 g/mol. Its IUPAC name is 6-iodo-7H-purin-2-amine.
Molecular Properties
| Compound Name | 6-iodo-7H-purin-2-amine |
| PubChem CID | 6101575 |
| Molecular Formula | C5H4IN5 |
| Molecular Weight | 261.03 g/mol |
| Exact Mass | 260.95 |
| IUPAC Name | 6-iodo-7H-purin-2-amine |
| SMILES | Nc1nc(I)c2[nH]cnc2n1 |
| InChI | InChI=1S/C5H4IN5/c6-3-2-4(9-1-8-2)11-5(7)10-3/h1H,(H3,7,8,9,10,11) |
| InChIKey | CQYPNVKLVHHOSJ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.03 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-iodo-7H-purin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-iodo-7H-purin-2-amine?
The IUPAC name of 6-iodo-7H-purin-2-amine (CID 6101575) is 6-iodo-7H-purin-2-amine.
What is the SMILES notation for 6-iodo-7H-purin-2-amine?
The canonical SMILES for 6-iodo-7H-purin-2-amine is Nc1nc(I)c2[nH]cnc2n1.
What is the InChIKey of 6-iodo-7H-purin-2-amine?
The InChIKey is CQYPNVKLVHHOSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4IN5/c6-3-2-4(9-1-8-2)11-5(7)10-3/h1H,(H3,7,8,9,10,11).
What are the key properties of 6-iodo-7H-purin-2-amine?
6-iodo-7H-purin-2-amine has a molecular weight of 261.03 g/mol, XLogP of 0.54, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-iodo-7H-purin-2-amine is sourced from PubChem (CID 6101575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).