About chloroaluminum(2+);bis(octane)
chloroaluminum(2+);bis(octane) (PubChem CID 6101597) has the molecular formula C16H34AlCl
and a molecular weight of 288.88 g/mol. Its IUPAC name is chloroaluminum(2+);bis(octane).
Molecular Properties
| Compound Name | chloroaluminum(2+);bis(octane) |
| PubChem CID | 6101597 |
| Molecular Formula | C16H34AlCl |
| Molecular Weight | 288.88 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | chloroaluminum(2+);bis(octane) |
| SMILES | [Al+2]Cl.[CH2-]CCCCCCC.[CH2-]CCCCCCC |
| InChI | InChI=1S/2C8H17.Al.ClH/c2*1-3-5-7-8-6-4-2;;/h2*1,3-8H2,2H3;;1H/q2*-1;+3;/p-1 |
| InChIKey | XDSOKTVRSBUDBC-UHFFFAOYSA-M |
| XLogP | 6.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 288.88 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze chloroaluminum(2+);bis(octane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroaluminum(2+);bis(octane)?
The IUPAC name of chloroaluminum(2+);bis(octane) (CID 6101597) is chloroaluminum(2+);bis(octane).
What is the SMILES notation for chloroaluminum(2+);bis(octane)?
The canonical SMILES for chloroaluminum(2+);bis(octane) is [Al+2]Cl.[CH2-]CCCCCCC.[CH2-]CCCCCCC.
What is the InChIKey of chloroaluminum(2+);bis(octane)?
The InChIKey is XDSOKTVRSBUDBC-UHFFFAOYSA-M. The full InChI is InChI=1S/2C8H17.Al.ClH/c2*1-3-5-7-8-6-4-2;;/h2*1,3-8H2,2H3;;1H/q2*-1;+3;/p-1.
What are the key properties of chloroaluminum(2+);bis(octane)?
chloroaluminum(2+);bis(octane) has a molecular weight of 288.88 g/mol, XLogP of 6.67, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloroaluminum(2+);bis(octane) is sourced from PubChem (CID 6101597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).