C8H7F5N2 — CID 61016127
2,6-difluoro-1-N-(2,2,2-trifluoroethyl)benzene-1,4-diamine (PubChem CID 61016127) has the molecular formula C8H7F5N2 and a molecular weight of 226.15 g/mol. Its IUPAC name is 2,6-difluoro-1-N-(2,2,2-trifluoroethyl)benzene-1,4-diamine.
| Compound Name | 2,6-difluoro-1-N-(2,2,2-trifluoroethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 61016127 |
| Molecular Formula | C8H7F5N2 |
| Molecular Weight | 226.15 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 2,6-difluoro-1-N-(2,2,2-trifluoroethyl)benzene-1,4-diamine |
| SMILES | Nc1cc(F)c(NCC(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C8H7F5N2/c9-5-1-4(14)2-6(10)7(5)15-3-8(11,12)13/h1-2,15H,3,14H2 |
| InChIKey | BQHFKHGJZJZSLK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.15 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|