About 1-N-[3-(dimethylamino)propyl]-2,6-difluorobenzene-1,4-diamine
1-N-[3-(dimethylamino)propyl]-2,6-difluorobenzene-1,4-diamine (PubChem CID 61016451) has the molecular formula C11H17F2N3
and a molecular weight of 229.27 g/mol. Its IUPAC name is 1-N-[3-(dimethylamino)propyl]-2,6-difluorobenzene-1,4-diamine.
Molecular Properties
| Compound Name | 1-N-[3-(dimethylamino)propyl]-2,6-difluorobenzene-1,4-diamine |
| PubChem CID | 61016451 |
| Molecular Formula | C11H17F2N3 |
| Molecular Weight | 229.27 g/mol |
| Exact Mass | 229.14 |
| IUPAC Name | 1-N-[3-(dimethylamino)propyl]-2,6-difluorobenzene-1,4-diamine |
| SMILES | CN(C)CCCNc1c(F)cc(N)cc1F |
| InChI | InChI=1S/C11H17F2N3/c1-16(2)5-3-4-15-11-9(12)6-8(14)7-10(11)13/h6-7,15H,3-5,14H2,1-2H3 |
| InChIKey | LKNROQPTLDLXBE-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-N-[3-(dimethylamino)propyl]-2,6-difluorobenzene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-[3-(dimethylamino)propyl]-2,6-difluorobenzene-1,4-diamine?
The IUPAC name of 1-N-[3-(dimethylamino)propyl]-2,6-difluorobenzene-1,4-diamine (CID 61016451) is 1-N-[3-(dimethylamino)propyl]-2,6-difluorobenzene-1,4-diamine.
What is the SMILES notation for 1-N-[3-(dimethylamino)propyl]-2,6-difluorobenzene-1,4-diamine?
The canonical SMILES for 1-N-[3-(dimethylamino)propyl]-2,6-difluorobenzene-1,4-diamine is CN(C)CCCNc1c(F)cc(N)cc1F.
What is the InChIKey of 1-N-[3-(dimethylamino)propyl]-2,6-difluorobenzene-1,4-diamine?
The InChIKey is LKNROQPTLDLXBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F2N3/c1-16(2)5-3-4-15-11-9(12)6-8(14)7-10(11)13/h6-7,15H,3-5,14H2,1-2H3.
What are the key properties of 1-N-[3-(dimethylamino)propyl]-2,6-difluorobenzene-1,4-diamine?
1-N-[3-(dimethylamino)propyl]-2,6-difluorobenzene-1,4-diamine has a molecular weight of 229.27 g/mol, XLogP of 1.91, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-[3-(dimethylamino)propyl]-2,6-difluorobenzene-1,4-diamine is sourced from PubChem (CID 61016451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).