C10H10BrClFNO — CID 61017025
N-[(2-bromo-5-fluorophenyl)methyl]-2-chloropropanamide (PubChem CID 61017025) has the molecular formula C10H10BrClFNO and a molecular weight of 294.55 g/mol. Its IUPAC name is N-[(2-bromo-5-fluorophenyl)methyl]-2-chloropropanamide.
| Compound Name | N-[(2-bromo-5-fluorophenyl)methyl]-2-chloropropanamide |
|---|---|
| PubChem CID | 61017025 |
| Molecular Formula | C10H10BrClFNO |
| Molecular Weight | 294.55 g/mol |
| Exact Mass | 292.96 |
| IUPAC Name | N-[(2-bromo-5-fluorophenyl)methyl]-2-chloropropanamide |
| SMILES | CC(Cl)C(=O)NCc1cc(F)ccc1Br |
| InChI | InChI=1S/C10H10BrClFNO/c1-6(12)10(15)14-5-7-4-8(13)2-3-9(7)11/h2-4,6H,5H2,1H3,(H,14,15) |
| InChIKey | QXMPURQPKRGXLL-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.55 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|