About bis(ethane-1,2-dithiolate);tin(4+)
bis(ethane-1,2-dithiolate);tin(4+) (PubChem CID 6101787) has the molecular formula C4H8S4Sn
and a molecular weight of 303.09 g/mol. Its IUPAC name is bis(ethane-1,2-dithiolate);tin(4+).
Molecular Properties
| Compound Name | bis(ethane-1,2-dithiolate);tin(4+) |
| PubChem CID | 6101787 |
| Molecular Formula | C4H8S4Sn |
| Molecular Weight | 303.09 g/mol |
| Exact Mass | 303.85 |
| IUPAC Name | bis(ethane-1,2-dithiolate);tin(4+) |
| SMILES | [S-]CC[S-].[S-]CC[S-].[Sn+4] |
| InChI | InChI=1S/2C2H6S2.Sn/c2*3-1-2-4;/h2*3-4H,1-2H2;/q;;+4/p-4 |
| InChIKey | JHOKIZLXPNZHLP-UHFFFAOYSA-J |
| XLogP | -0.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.09 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze bis(ethane-1,2-dithiolate);tin(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(ethane-1,2-dithiolate);tin(4+)?
The IUPAC name of bis(ethane-1,2-dithiolate);tin(4+) (CID 6101787) is bis(ethane-1,2-dithiolate);tin(4+).
What is the SMILES notation for bis(ethane-1,2-dithiolate);tin(4+)?
The canonical SMILES for bis(ethane-1,2-dithiolate);tin(4+) is [S-]CC[S-].[S-]CC[S-].[Sn+4].
What is the InChIKey of bis(ethane-1,2-dithiolate);tin(4+)?
The InChIKey is JHOKIZLXPNZHLP-UHFFFAOYSA-J. The full InChI is InChI=1S/2C2H6S2.Sn/c2*3-1-2-4;/h2*3-4H,1-2H2;/q;;+4/p-4.
What are the key properties of bis(ethane-1,2-dithiolate);tin(4+)?
bis(ethane-1,2-dithiolate);tin(4+) has a molecular weight of 303.09 g/mol, XLogP of -0.22, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(ethane-1,2-dithiolate);tin(4+) is sourced from PubChem (CID 6101787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).