C10H10N4O3 — CID 61018085
2-[4-(1H-pyrrole-2-carbonylamino)pyrazol-1-yl]acetic acid (PubChem CID 61018085) has the molecular formula C10H10N4O3 and a molecular weight of 234.22 g/mol. Its IUPAC name is 2-[4-(1H-pyrrole-2-carbonylamino)pyrazol-1-yl]acetic acid.
| Compound Name | 2-[4-(1H-pyrrole-2-carbonylamino)pyrazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 61018085 |
| Molecular Formula | C10H10N4O3 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 2-[4-(1H-pyrrole-2-carbonylamino)pyrazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1cc(NC(=O)c2ccc[nH]2)cn1 |
| InChI | InChI=1S/C10H10N4O3/c15-9(16)6-14-5-7(4-12-14)13-10(17)8-2-1-3-11-8/h1-5,11H,6H2,(H,13,17)(H,15,16) |
| InChIKey | LRMUBSBILQKFRP-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |