C10H11N3O4 — CID 61018256
2-[4-(2,6-dioxopiperidin-1-yl)pyrazol-1-yl]acetic acid (PubChem CID 61018256) has the molecular formula C10H11N3O4 and a molecular weight of 237.21 g/mol. Its IUPAC name is 2-[4-(2,6-dioxopiperidin-1-yl)pyrazol-1-yl]acetic acid.
| Compound Name | 2-[4-(2,6-dioxopiperidin-1-yl)pyrazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 61018256 |
| Molecular Formula | C10H11N3O4 |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 2-[4-(2,6-dioxopiperidin-1-yl)pyrazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1cc(N2C(=O)CCCC2=O)cn1 |
| InChI | InChI=1S/C10H11N3O4/c14-8-2-1-3-9(15)13(8)7-4-11-12(5-7)6-10(16)17/h4-5H,1-3,6H2,(H,16,17) |
| InChIKey | MCPYFDOMNMTAQQ-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|