About 2-[2,2-difluoroethyl(methyl)amino]-1-piperazin-1-ylethanone
2-[2,2-difluoroethyl(methyl)amino]-1-piperazin-1-ylethanone (PubChem CID 61018687) has the molecular formula C9H17F2N3O
and a molecular weight of 221.25 g/mol. Its IUPAC name is 2-[2,2-difluoroethyl(methyl)amino]-1-piperazin-1-ylethanone.
Molecular Properties
| Compound Name | 2-[2,2-difluoroethyl(methyl)amino]-1-piperazin-1-ylethanone |
| PubChem CID | 61018687 |
| Molecular Formula | C9H17F2N3O |
| Molecular Weight | 221.25 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | 2-[2,2-difluoroethyl(methyl)amino]-1-piperazin-1-ylethanone |
| SMILES | CN(CC(=O)N1CCNCC1)CC(F)F |
| InChI | InChI=1S/C9H17F2N3O/c1-13(6-8(10)11)7-9(15)14-4-2-12-3-5-14/h8,12H,2-7H2,1H3 |
| InChIKey | YJQUTDBHFCQSGM-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.25 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2,2-difluoroethyl(methyl)amino]-1-piperazin-1-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,2-difluoroethyl(methyl)amino]-1-piperazin-1-ylethanone?
The IUPAC name of 2-[2,2-difluoroethyl(methyl)amino]-1-piperazin-1-ylethanone (CID 61018687) is 2-[2,2-difluoroethyl(methyl)amino]-1-piperazin-1-ylethanone.
What is the SMILES notation for 2-[2,2-difluoroethyl(methyl)amino]-1-piperazin-1-ylethanone?
The canonical SMILES for 2-[2,2-difluoroethyl(methyl)amino]-1-piperazin-1-ylethanone is CN(CC(=O)N1CCNCC1)CC(F)F.
What is the InChIKey of 2-[2,2-difluoroethyl(methyl)amino]-1-piperazin-1-ylethanone?
The InChIKey is YJQUTDBHFCQSGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F2N3O/c1-13(6-8(10)11)7-9(15)14-4-2-12-3-5-14/h8,12H,2-7H2,1H3.
What are the key properties of 2-[2,2-difluoroethyl(methyl)amino]-1-piperazin-1-ylethanone?
2-[2,2-difluoroethyl(methyl)amino]-1-piperazin-1-ylethanone has a molecular weight of 221.25 g/mol, XLogP of -0.38, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,2-difluoroethyl(methyl)amino]-1-piperazin-1-ylethanone is sourced from PubChem (CID 61018687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).