C11H18ClN3O — CID 61020728
N-[(5-chloro-1-methylimidazol-2-yl)methyl]-1-(oxan-3-yl)methanamine (PubChem CID 61020728) has the molecular formula C11H18ClN3O and a molecular weight of 243.74 g/mol. Its IUPAC name is N-[(5-chloro-1-methylimidazol-2-yl)methyl]-1-(oxan-3-yl)methanamine.
| Compound Name | N-[(5-chloro-1-methylimidazol-2-yl)methyl]-1-(oxan-3-yl)methanamine |
|---|---|
| PubChem CID | 61020728 |
| Molecular Formula | C11H18ClN3O |
| Molecular Weight | 243.74 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | N-[(5-chloro-1-methylimidazol-2-yl)methyl]-1-(oxan-3-yl)methanamine |
| SMILES | Cn1c(Cl)cnc1CNCC1CCCOC1 |
| InChI | InChI=1S/C11H18ClN3O/c1-15-10(12)6-14-11(15)7-13-5-9-3-2-4-16-8-9/h6,9,13H,2-5,7-8H2,1H3 |
| InChIKey | KLJIJAAZSUUCPL-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.74 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |