C13H15FN2O4 — CID 61021393
2-[ethyl-[2-[(2-fluorobenzoyl)amino]acetyl]amino]acetic acid (PubChem CID 61021393) has the molecular formula C13H15FN2O4 and a molecular weight of 282.27 g/mol. Its IUPAC name is 2-[ethyl-[2-[(2-fluorobenzoyl)amino]acetyl]amino]acetic acid.
| Compound Name | 2-[ethyl-[2-[(2-fluorobenzoyl)amino]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 61021393 |
| Molecular Formula | C13H15FN2O4 |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 2-[ethyl-[2-[(2-fluorobenzoyl)amino]acetyl]amino]acetic acid |
| SMILES | CCN(CC(=O)O)C(=O)CNC(=O)c1ccccc1F |
| InChI | InChI=1S/C13H15FN2O4/c1-2-16(8-12(18)19)11(17)7-15-13(20)9-5-3-4-6-10(9)14/h3-6H,2,7-8H2,1H3,(H,15,20)(H,18,19) |
| InChIKey | BRSVZJRQEYVBOJ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |