C15H23FN2O2 — CID 61022469
N-butan-2-yl-3-[[2-(2-fluorophenyl)-2-hydroxyethyl]amino]propanamide (PubChem CID 61022469) has the molecular formula C15H23FN2O2 and a molecular weight of 282.36 g/mol. Its IUPAC name is N-butan-2-yl-3-[[2-(2-fluorophenyl)-2-hydroxyethyl]amino]propanamide.
| Compound Name | N-butan-2-yl-3-[[2-(2-fluorophenyl)-2-hydroxyethyl]amino]propanamide |
|---|---|
| PubChem CID | 61022469 |
| Molecular Formula | C15H23FN2O2 |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | N-butan-2-yl-3-[[2-(2-fluorophenyl)-2-hydroxyethyl]amino]propanamide |
| SMILES | CCC(C)NC(=O)CCNCC(O)c1ccccc1F |
| InChI | InChI=1S/C15H23FN2O2/c1-3-11(2)18-15(20)8-9-17-10-14(19)12-6-4-5-7-13(12)16/h4-7,11,14,17,19H,3,8-10H2,1-2H3,(H,18,20) |
| InChIKey | XTHUIBIXDBMOHA-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|