About 2-bromo-N-(1,4-dioxan-2-ylmethyl)prop-2-en-1-amine
2-bromo-N-(1,4-dioxan-2-ylmethyl)prop-2-en-1-amine (PubChem CID 61023147) has the molecular formula C8H14BrNO2
and a molecular weight of 236.11 g/mol. Its IUPAC name is 2-bromo-N-(1,4-dioxan-2-ylmethyl)prop-2-en-1-amine.
Molecular Properties
| Compound Name | 2-bromo-N-(1,4-dioxan-2-ylmethyl)prop-2-en-1-amine |
| PubChem CID | 61023147 |
| Molecular Formula | C8H14BrNO2 |
| Molecular Weight | 236.11 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | 2-bromo-N-(1,4-dioxan-2-ylmethyl)prop-2-en-1-amine |
| SMILES | C=C(Br)CNCC1COCCO1 |
| InChI | InChI=1S/C8H14BrNO2/c1-7(9)4-10-5-8-6-11-2-3-12-8/h8,10H,1-6H2 |
| InChIKey | IEDIBDLDFHHVBE-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.11 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-bromo-N-(1,4-dioxan-2-ylmethyl)prop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N-(1,4-dioxan-2-ylmethyl)prop-2-en-1-amine?
The IUPAC name of 2-bromo-N-(1,4-dioxan-2-ylmethyl)prop-2-en-1-amine (CID 61023147) is 2-bromo-N-(1,4-dioxan-2-ylmethyl)prop-2-en-1-amine.
What is the SMILES notation for 2-bromo-N-(1,4-dioxan-2-ylmethyl)prop-2-en-1-amine?
The canonical SMILES for 2-bromo-N-(1,4-dioxan-2-ylmethyl)prop-2-en-1-amine is C=C(Br)CNCC1COCCO1.
What is the InChIKey of 2-bromo-N-(1,4-dioxan-2-ylmethyl)prop-2-en-1-amine?
The InChIKey is IEDIBDLDFHHVBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14BrNO2/c1-7(9)4-10-5-8-6-11-2-3-12-8/h8,10H,1-6H2.
What are the key properties of 2-bromo-N-(1,4-dioxan-2-ylmethyl)prop-2-en-1-amine?
2-bromo-N-(1,4-dioxan-2-ylmethyl)prop-2-en-1-amine has a molecular weight of 236.11 g/mol, XLogP of 0.90, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N-(1,4-dioxan-2-ylmethyl)prop-2-en-1-amine is sourced from PubChem (CID 61023147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).