About N-(cyanomethyl)-2-(1,4-dioxan-2-ylmethylamino)acetamide
N-(cyanomethyl)-2-(1,4-dioxan-2-ylmethylamino)acetamide (PubChem CID 61023152) has the molecular formula C9H15N3O3
and a molecular weight of 213.24 g/mol. Its IUPAC name is N-(cyanomethyl)-2-(1,4-dioxan-2-ylmethylamino)acetamide.
Molecular Properties
| Compound Name | N-(cyanomethyl)-2-(1,4-dioxan-2-ylmethylamino)acetamide |
| PubChem CID | 61023152 |
| Molecular Formula | C9H15N3O3 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | N-(cyanomethyl)-2-(1,4-dioxan-2-ylmethylamino)acetamide |
| SMILES | N#CCNC(=O)CNCC1COCCO1 |
| InChI | InChI=1S/C9H15N3O3/c10-1-2-12-9(13)6-11-5-8-7-14-3-4-15-8/h8,11H,2-7H2,(H,12,13) |
| InChIKey | UPCLRUWLYWTHHZ-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze N-(cyanomethyl)-2-(1,4-dioxan-2-ylmethylamino)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyanomethyl)-2-(1,4-dioxan-2-ylmethylamino)acetamide?
The IUPAC name of N-(cyanomethyl)-2-(1,4-dioxan-2-ylmethylamino)acetamide (CID 61023152) is N-(cyanomethyl)-2-(1,4-dioxan-2-ylmethylamino)acetamide.
What is the SMILES notation for N-(cyanomethyl)-2-(1,4-dioxan-2-ylmethylamino)acetamide?
The canonical SMILES for N-(cyanomethyl)-2-(1,4-dioxan-2-ylmethylamino)acetamide is N#CCNC(=O)CNCC1COCCO1.
What is the InChIKey of N-(cyanomethyl)-2-(1,4-dioxan-2-ylmethylamino)acetamide?
The InChIKey is UPCLRUWLYWTHHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O3/c10-1-2-12-9(13)6-11-5-8-7-14-3-4-15-8/h8,11H,2-7H2,(H,12,13).
What are the key properties of N-(cyanomethyl)-2-(1,4-dioxan-2-ylmethylamino)acetamide?
N-(cyanomethyl)-2-(1,4-dioxan-2-ylmethylamino)acetamide has a molecular weight of 213.24 g/mol, XLogP of -1.37, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyanomethyl)-2-(1,4-dioxan-2-ylmethylamino)acetamide is sourced from PubChem (CID 61023152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).