C13H15N5O3 — CID 61023544
8-[2-(furan-2-yl)ethylamino]-1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 61023544) has the molecular formula C13H15N5O3 and a molecular weight of 289.29 g/mol. Its IUPAC name is 8-[2-(furan-2-yl)ethylamino]-1,3-dimethyl-7H-purine-2,6-dione.
| Compound Name | 8-[2-(furan-2-yl)ethylamino]-1,3-dimethyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 61023544 |
| Molecular Formula | C13H15N5O3 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 8-[2-(furan-2-yl)ethylamino]-1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)c2[nH]c(NCCc3ccco3)nc2n(C)c1=O |
| InChI | InChI=1S/C13H15N5O3/c1-17-10-9(11(19)18(2)13(17)20)15-12(16-10)14-6-5-8-4-3-7-21-8/h3-4,7H,5-6H2,1-2H3,(H2,14,15,16) |
| InChIKey | OYIIVYSYKQAOON-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 97.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |