C11H12N4O5 — CID 61023801
2-methyl-5-[[(3-methyl-5-nitroimidazol-4-yl)amino]methyl]furan-3-carboxylic acid (PubChem CID 61023801) has the molecular formula C11H12N4O5 and a molecular weight of 280.24 g/mol. Its IUPAC name is 2-methyl-5-[[(3-methyl-5-nitroimidazol-4-yl)amino]methyl]furan-3-carboxylic acid.
| Compound Name | 2-methyl-5-[[(3-methyl-5-nitroimidazol-4-yl)amino]methyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 61023801 |
| Molecular Formula | C11H12N4O5 |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 2-methyl-5-[[(3-methyl-5-nitroimidazol-4-yl)amino]methyl]furan-3-carboxylic acid |
| SMILES | Cc1oc(CNc2c([N+](=O)[O-])ncn2C)cc1C(=O)O |
| InChI | InChI=1S/C11H12N4O5/c1-6-8(11(16)17)3-7(20-6)4-12-9-10(15(18)19)13-5-14(9)2/h3,5,12H,4H2,1-2H3,(H,16,17) |
| InChIKey | QZTFUPALOSDNSG-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 123.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|