About 3-chloro-N-(1,4-dioxan-2-ylmethyl)propanamide
3-chloro-N-(1,4-dioxan-2-ylmethyl)propanamide (PubChem CID 61023821) has the molecular formula C8H14ClNO3
and a molecular weight of 207.66 g/mol. Its IUPAC name is 3-chloro-N-(1,4-dioxan-2-ylmethyl)propanamide.
Molecular Properties
| Compound Name | 3-chloro-N-(1,4-dioxan-2-ylmethyl)propanamide |
| PubChem CID | 61023821 |
| Molecular Formula | C8H14ClNO3 |
| Molecular Weight | 207.66 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 3-chloro-N-(1,4-dioxan-2-ylmethyl)propanamide |
| SMILES | O=C(CCCl)NCC1COCCO1 |
| InChI | InChI=1S/C8H14ClNO3/c9-2-1-8(11)10-5-7-6-12-3-4-13-7/h7H,1-6H2,(H,10,11) |
| InChIKey | IVNCZPYIRMTHHX-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.66 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-N-(1,4-dioxan-2-ylmethyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-(1,4-dioxan-2-ylmethyl)propanamide?
The IUPAC name of 3-chloro-N-(1,4-dioxan-2-ylmethyl)propanamide (CID 61023821) is 3-chloro-N-(1,4-dioxan-2-ylmethyl)propanamide.
What is the SMILES notation for 3-chloro-N-(1,4-dioxan-2-ylmethyl)propanamide?
The canonical SMILES for 3-chloro-N-(1,4-dioxan-2-ylmethyl)propanamide is O=C(CCCl)NCC1COCCO1.
What is the InChIKey of 3-chloro-N-(1,4-dioxan-2-ylmethyl)propanamide?
The InChIKey is IVNCZPYIRMTHHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14ClNO3/c9-2-1-8(11)10-5-7-6-12-3-4-13-7/h7H,1-6H2,(H,10,11).
What are the key properties of 3-chloro-N-(1,4-dioxan-2-ylmethyl)propanamide?
3-chloro-N-(1,4-dioxan-2-ylmethyl)propanamide has a molecular weight of 207.66 g/mol, XLogP of 0.15, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-(1,4-dioxan-2-ylmethyl)propanamide is sourced from PubChem (CID 61023821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).