About N-(2-aminoethyl)-N'-(1,4-dioxan-2-ylmethyl)oxamide
N-(2-aminoethyl)-N'-(1,4-dioxan-2-ylmethyl)oxamide (PubChem CID 61023960) has the molecular formula C9H17N3O4
and a molecular weight of 231.25 g/mol. Its IUPAC name is N-(2-aminoethyl)-N'-(1,4-dioxan-2-ylmethyl)oxamide.
Molecular Properties
| Compound Name | N-(2-aminoethyl)-N'-(1,4-dioxan-2-ylmethyl)oxamide |
| PubChem CID | 61023960 |
| Molecular Formula | C9H17N3O4 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | N-(2-aminoethyl)-N'-(1,4-dioxan-2-ylmethyl)oxamide |
| SMILES | NCCNC(=O)C(=O)NCC1COCCO1 |
| InChI | InChI=1S/C9H17N3O4/c10-1-2-11-8(13)9(14)12-5-7-6-15-3-4-16-7/h7H,1-6,10H2,(H,11,13)(H,12,14) |
| InChIKey | FYGUWSRWOYDWHB-UHFFFAOYSA-N |
| XLogP | -2.41 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(2-aminoethyl)-N'-(1,4-dioxan-2-ylmethyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminoethyl)-N'-(1,4-dioxan-2-ylmethyl)oxamide?
The IUPAC name of N-(2-aminoethyl)-N'-(1,4-dioxan-2-ylmethyl)oxamide (CID 61023960) is N-(2-aminoethyl)-N'-(1,4-dioxan-2-ylmethyl)oxamide.
What is the SMILES notation for N-(2-aminoethyl)-N'-(1,4-dioxan-2-ylmethyl)oxamide?
The canonical SMILES for N-(2-aminoethyl)-N'-(1,4-dioxan-2-ylmethyl)oxamide is NCCNC(=O)C(=O)NCC1COCCO1.
What is the InChIKey of N-(2-aminoethyl)-N'-(1,4-dioxan-2-ylmethyl)oxamide?
The InChIKey is FYGUWSRWOYDWHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O4/c10-1-2-11-8(13)9(14)12-5-7-6-15-3-4-16-7/h7H,1-6,10H2,(H,11,13)(H,12,14).
What are the key properties of N-(2-aminoethyl)-N'-(1,4-dioxan-2-ylmethyl)oxamide?
N-(2-aminoethyl)-N'-(1,4-dioxan-2-ylmethyl)oxamide has a molecular weight of 231.25 g/mol, XLogP of -2.41, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminoethyl)-N'-(1,4-dioxan-2-ylmethyl)oxamide is sourced from PubChem (CID 61023960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).