About 4-bromo-1-N-(1,4-dioxan-2-ylmethyl)benzene-1,2-diamine
4-bromo-1-N-(1,4-dioxan-2-ylmethyl)benzene-1,2-diamine (PubChem CID 61024350) has the molecular formula C11H15BrN2O2
and a molecular weight of 287.16 g/mol. Its IUPAC name is 4-bromo-1-N-(1,4-dioxan-2-ylmethyl)benzene-1,2-diamine.
Molecular Properties
| Compound Name | 4-bromo-1-N-(1,4-dioxan-2-ylmethyl)benzene-1,2-diamine |
| PubChem CID | 61024350 |
| Molecular Formula | C11H15BrN2O2 |
| Molecular Weight | 287.16 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 4-bromo-1-N-(1,4-dioxan-2-ylmethyl)benzene-1,2-diamine |
| SMILES | Nc1cc(Br)ccc1NCC1COCCO1 |
| InChI | InChI=1S/C11H15BrN2O2/c12-8-1-2-11(10(13)5-8)14-6-9-7-15-3-4-16-9/h1-2,5,9,14H,3-4,6-7,13H2 |
| InChIKey | WKZFTMHZORSESR-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.16 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-1-N-(1,4-dioxan-2-ylmethyl)benzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1-N-(1,4-dioxan-2-ylmethyl)benzene-1,2-diamine?
The IUPAC name of 4-bromo-1-N-(1,4-dioxan-2-ylmethyl)benzene-1,2-diamine (CID 61024350) is 4-bromo-1-N-(1,4-dioxan-2-ylmethyl)benzene-1,2-diamine.
What is the SMILES notation for 4-bromo-1-N-(1,4-dioxan-2-ylmethyl)benzene-1,2-diamine?
The canonical SMILES for 4-bromo-1-N-(1,4-dioxan-2-ylmethyl)benzene-1,2-diamine is Nc1cc(Br)ccc1NCC1COCCO1.
What is the InChIKey of 4-bromo-1-N-(1,4-dioxan-2-ylmethyl)benzene-1,2-diamine?
The InChIKey is WKZFTMHZORSESR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15BrN2O2/c12-8-1-2-11(10(13)5-8)14-6-9-7-15-3-4-16-9/h1-2,5,9,14H,3-4,6-7,13H2.
What are the key properties of 4-bromo-1-N-(1,4-dioxan-2-ylmethyl)benzene-1,2-diamine?
4-bromo-1-N-(1,4-dioxan-2-ylmethyl)benzene-1,2-diamine has a molecular weight of 287.16 g/mol, XLogP of 1.86, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1-N-(1,4-dioxan-2-ylmethyl)benzene-1,2-diamine is sourced from PubChem (CID 61024350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).