methyl 2-(butan-2-ylamino)-2-(3,4-dimethoxyphenyl)acetate

C15H23NO4 — CID 61024813

IUPACmethyl 2-(butan-2-ylamino)-2-(3,4-dimethoxyphenyl)acetate
SMILESCCC(C)NC(C(=O)OC)c1ccc(OC)c(OC)c1
InChIInChI=1S/C15H23NO4/c1-6-10(2)16-14(15(17)20-5)11-7-8-12(18-3)13(9-11)19-4/h7-10,14,16H,6H2,1-5H3
InChIKeyHWGYMJIQHZFGLE-UHFFFAOYSA-N
MW281.35 g/mol
LogP2.31
Rot. Bonds7

About methyl 2-(butan-2-ylamino)-2-(3,4-dimethoxyphenyl)acetate

methyl 2-(butan-2-ylamino)-2-(3,4-dimethoxyphenyl)acetate (PubChem CID 61024813) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is methyl 2-(butan-2-ylamino)-2-(3,4-dimethoxyphenyl)acetate.

Molecular Properties

Compound Namemethyl 2-(butan-2-ylamino)-2-(3,4-dimethoxyphenyl)acetate
PubChem CID61024813
Molecular FormulaC15H23NO4
Molecular Weight281.35 g/mol
Exact Mass281.16
IUPAC Namemethyl 2-(butan-2-ylamino)-2-(3,4-dimethoxyphenyl)acetate
SMILESCCC(C)NC(C(=O)OC)c1ccc(OC)c(OC)c1
InChIInChI=1S/C15H23NO4/c1-6-10(2)16-14(15(17)20-5)11-7-8-12(18-3)13(9-11)19-4/h7-10,14,16H,6H2,1-5H3
InChIKeyHWGYMJIQHZFGLE-UHFFFAOYSA-N
XLogP2.31
TPSA56.79 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.35
LogP ≤ 52.31
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 2-(butan-2-ylamino)-2-(3,4-dimethoxyphenyl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(butan-2-ylamino)-2-(3,4-dimethoxyphenyl)acetate?
The IUPAC name of methyl 2-(butan-2-ylamino)-2-(3,4-dimethoxyphenyl)acetate (CID 61024813) is methyl 2-(butan-2-ylamino)-2-(3,4-dimethoxyphenyl)acetate.
What is the SMILES notation for methyl 2-(butan-2-ylamino)-2-(3,4-dimethoxyphenyl)acetate?
The canonical SMILES for methyl 2-(butan-2-ylamino)-2-(3,4-dimethoxyphenyl)acetate is CCC(C)NC(C(=O)OC)c1ccc(OC)c(OC)c1.
What is the InChIKey of methyl 2-(butan-2-ylamino)-2-(3,4-dimethoxyphenyl)acetate?
The InChIKey is HWGYMJIQHZFGLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO4/c1-6-10(2)16-14(15(17)20-5)11-7-8-12(18-3)13(9-11)19-4/h7-10,14,16H,6H2,1-5H3.
What are the key properties of methyl 2-(butan-2-ylamino)-2-(3,4-dimethoxyphenyl)acetate?
methyl 2-(butan-2-ylamino)-2-(3,4-dimethoxyphenyl)acetate has a molecular weight of 281.35 g/mol, XLogP of 2.31, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(butan-2-ylamino)-2-(3,4-dimethoxyphenyl)acetate is sourced from PubChem (CID 61024813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).