C8H10N2O5 — CID 61024888
1-(1,4-dioxan-2-ylmethyl)imidazolidine-2,4,5-trione (PubChem CID 61024888) has the molecular formula C8H10N2O5 and a molecular weight of 214.18 g/mol. Its IUPAC name is 1-(1,4-dioxan-2-ylmethyl)imidazolidine-2,4,5-trione.
| Compound Name | 1-(1,4-dioxan-2-ylmethyl)imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 61024888 |
| Molecular Formula | C8H10N2O5 |
| Molecular Weight | 214.18 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 1-(1,4-dioxan-2-ylmethyl)imidazolidine-2,4,5-trione |
| SMILES | O=C1NC(=O)N(CC2COCCO2)C1=O |
| InChI | InChI=1S/C8H10N2O5/c11-6-7(12)10(8(13)9-6)3-5-4-14-1-2-15-5/h5H,1-4H2,(H,9,11,13) |
| InChIKey | HYJTTWKSTMEWDO-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.18 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|