C10H11NO4 — CID 61025083
2-methyl-5-[(prop-2-enoylamino)methyl]furan-3-carboxylic acid (PubChem CID 61025083) has the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. Its IUPAC name is 2-methyl-5-[(prop-2-enoylamino)methyl]furan-3-carboxylic acid.
| Compound Name | 2-methyl-5-[(prop-2-enoylamino)methyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 61025083 |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 2-methyl-5-[(prop-2-enoylamino)methyl]furan-3-carboxylic acid |
| SMILES | C=CC(=O)NCc1cc(C(=O)O)c(C)o1 |
| InChI | InChI=1S/C10H11NO4/c1-3-9(12)11-5-7-4-8(10(13)14)6(2)15-7/h3-4H,1,5H2,2H3,(H,11,12)(H,13,14) |
| InChIKey | PDXXHALRSOHDQX-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|