About 4-(4,4,6-trimethyl-7-oxabicyclo[4.1.0]hept-2-en-2-yl)morpholine
4-(4,4,6-trimethyl-7-oxabicyclo[4.1.0]hept-2-en-2-yl)morpholine (PubChem CID 610274) has the molecular formula C13H21NO2
and a molecular weight of 223.32 g/mol. Its IUPAC name is 4-(4,4,6-trimethyl-7-oxabicyclo[4.1.0]hept-2-en-2-yl)morpholine.
Molecular Properties
| Compound Name | 4-(4,4,6-trimethyl-7-oxabicyclo[4.1.0]hept-2-en-2-yl)morpholine |
| PubChem CID | 610274 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 4-(4,4,6-trimethyl-7-oxabicyclo[4.1.0]hept-2-en-2-yl)morpholine |
| SMILES | CC1(C)C=C(N2CCOCC2)C2OC2(C)C1 |
| InChI | InChI=1S/C13H21NO2/c1-12(2)8-10(11-13(3,9-12)16-11)14-4-6-15-7-5-14/h8,11H,4-7,9H2,1-3H3 |
| InChIKey | YAPFVXXELFWHBT-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 25.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 4-(4,4,6-trimethyl-7-oxabicyclo[4.1.0]hept-2-en-2-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,4,6-trimethyl-7-oxabicyclo[4.1.0]hept-2-en-2-yl)morpholine?
The IUPAC name of 4-(4,4,6-trimethyl-7-oxabicyclo[4.1.0]hept-2-en-2-yl)morpholine (CID 610274) is 4-(4,4,6-trimethyl-7-oxabicyclo[4.1.0]hept-2-en-2-yl)morpholine.
What is the SMILES notation for 4-(4,4,6-trimethyl-7-oxabicyclo[4.1.0]hept-2-en-2-yl)morpholine?
The canonical SMILES for 4-(4,4,6-trimethyl-7-oxabicyclo[4.1.0]hept-2-en-2-yl)morpholine is CC1(C)C=C(N2CCOCC2)C2OC2(C)C1.
What is the InChIKey of 4-(4,4,6-trimethyl-7-oxabicyclo[4.1.0]hept-2-en-2-yl)morpholine?
The InChIKey is YAPFVXXELFWHBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO2/c1-12(2)8-10(11-13(3,9-12)16-11)14-4-6-15-7-5-14/h8,11H,4-7,9H2,1-3H3.
What are the key properties of 4-(4,4,6-trimethyl-7-oxabicyclo[4.1.0]hept-2-en-2-yl)morpholine?
4-(4,4,6-trimethyl-7-oxabicyclo[4.1.0]hept-2-en-2-yl)morpholine has a molecular weight of 223.32 g/mol, XLogP of 1.79, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,4,6-trimethyl-7-oxabicyclo[4.1.0]hept-2-en-2-yl)morpholine is sourced from PubChem (CID 610274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).