C15H11F3O2 — CID 61028637
3-[2-(2,2,2-trifluoroethoxy)naphthalen-1-yl]prop-2-yn-1-ol (PubChem CID 61028637) has the molecular formula C15H11F3O2 and a molecular weight of 280.25 g/mol. Its IUPAC name is 3-[2-(2,2,2-trifluoroethoxy)naphthalen-1-yl]prop-2-yn-1-ol.
| Compound Name | 3-[2-(2,2,2-trifluoroethoxy)naphthalen-1-yl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 61028637 |
| Molecular Formula | C15H11F3O2 |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 3-[2-(2,2,2-trifluoroethoxy)naphthalen-1-yl]prop-2-yn-1-ol |
| SMILES | OCC#Cc1c(OCC(F)(F)F)ccc2ccccc12 |
| InChI | InChI=1S/C15H11F3O2/c16-15(17,18)10-20-14-8-7-11-4-1-2-5-12(11)13(14)6-3-9-19/h1-2,4-5,7-8,19H,9-10H2 |
| InChIKey | HAUVHXVBCKHUOD-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|