About 4-bromo-1-hexylpyrazole
4-bromo-1-hexylpyrazole (PubChem CID 61029695) has the molecular formula C9H15BrN2
and a molecular weight of 231.14 g/mol. Its IUPAC name is 4-bromo-1-hexylpyrazole.
Molecular Properties
| Compound Name | 4-bromo-1-hexylpyrazole |
| PubChem CID | 61029695 |
| Molecular Formula | C9H15BrN2 |
| Molecular Weight | 231.14 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 4-bromo-1-hexylpyrazole |
| SMILES | CCCCCCn1cc(Br)cn1 |
| InChI | InChI=1S/C9H15BrN2/c1-2-3-4-5-6-12-8-9(10)7-11-12/h7-8H,2-6H2,1H3 |
| InChIKey | AHFIPMQOKZWMPI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.14 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-1-hexylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1-hexylpyrazole?
The IUPAC name of 4-bromo-1-hexylpyrazole (CID 61029695) is 4-bromo-1-hexylpyrazole.
What is the SMILES notation for 4-bromo-1-hexylpyrazole?
The canonical SMILES for 4-bromo-1-hexylpyrazole is CCCCCCn1cc(Br)cn1.
What is the InChIKey of 4-bromo-1-hexylpyrazole?
The InChIKey is AHFIPMQOKZWMPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15BrN2/c1-2-3-4-5-6-12-8-9(10)7-11-12/h7-8H,2-6H2,1H3.
What are the key properties of 4-bromo-1-hexylpyrazole?
4-bromo-1-hexylpyrazole has a molecular weight of 231.14 g/mol, XLogP of 3.23, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1-hexylpyrazole is sourced from PubChem (CID 61029695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).