C14H17ClN2O3 — CID 61029942
N-(6-chloro-1,3-benzodioxol-5-yl)-2-piperidin-4-ylacetamide (PubChem CID 61029942) has the molecular formula C14H17ClN2O3 and a molecular weight of 296.75 g/mol. Its IUPAC name is N-(6-chloro-1,3-benzodioxol-5-yl)-2-piperidin-4-ylacetamide.
| Compound Name | N-(6-chloro-1,3-benzodioxol-5-yl)-2-piperidin-4-ylacetamide |
|---|---|
| PubChem CID | 61029942 |
| Molecular Formula | C14H17ClN2O3 |
| Molecular Weight | 296.75 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | N-(6-chloro-1,3-benzodioxol-5-yl)-2-piperidin-4-ylacetamide |
| SMILES | O=C(CC1CCNCC1)Nc1cc2c(cc1Cl)OCO2 |
| InChI | InChI=1S/C14H17ClN2O3/c15-10-6-12-13(20-8-19-12)7-11(10)17-14(18)5-9-1-3-16-4-2-9/h6-7,9,16H,1-5,8H2,(H,17,18) |
| InChIKey | VFHYALIIOCOTFW-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.75 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |