C16H18FNO3 — CID 61032743
[4-fluoro-3-(2,4,6-trimethoxyphenyl)phenyl]methanamine (PubChem CID 61032743) has the molecular formula C16H18FNO3 and a molecular weight of 291.32 g/mol. Its IUPAC name is [4-fluoro-3-(2,4,6-trimethoxyphenyl)phenyl]methanamine.
| Compound Name | [4-fluoro-3-(2,4,6-trimethoxyphenyl)phenyl]methanamine |
|---|---|
| PubChem CID | 61032743 |
| Molecular Formula | C16H18FNO3 |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | [4-fluoro-3-(2,4,6-trimethoxyphenyl)phenyl]methanamine |
| SMILES | COc1cc(OC)c(-c2cc(CN)ccc2F)c(OC)c1 |
| InChI | InChI=1S/C16H18FNO3/c1-19-11-7-14(20-2)16(15(8-11)21-3)12-6-10(9-18)4-5-13(12)17/h4-8H,9,18H2,1-3H3 |
| InChIKey | NJOLPFQXBUAIDI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |